About (1-methylpiperidin-3-yl) 2-bromobenzoate
(1-methylpiperidin-3-yl) 2-bromobenzoate (PubChem CID 4991215) has the molecular formula C13H16BrNO2
and a molecular weight of 298.18 g/mol. Its IUPAC name is (1-methylpiperidin-3-yl) 2-bromobenzoate.
Molecular Properties
| Compound Name | (1-methylpiperidin-3-yl) 2-bromobenzoate |
| PubChem CID | 4991215 |
| Molecular Formula | C13H16BrNO2 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | (1-methylpiperidin-3-yl) 2-bromobenzoate |
| SMILES | CN1CCCC(OC(=O)c2ccccc2Br)C1 |
| InChI | InChI=1S/C13H16BrNO2/c1-15-8-4-5-10(9-15)17-13(16)11-6-2-3-7-12(11)14/h2-3,6-7,10H,4-5,8-9H2,1H3 |
| InChIKey | MTBWTESSKIGQPL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-methylpiperidin-3-yl) 2-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpiperidin-3-yl) 2-bromobenzoate?
The IUPAC name of (1-methylpiperidin-3-yl) 2-bromobenzoate (CID 4991215) is (1-methylpiperidin-3-yl) 2-bromobenzoate.
What is the SMILES notation for (1-methylpiperidin-3-yl) 2-bromobenzoate?
The canonical SMILES for (1-methylpiperidin-3-yl) 2-bromobenzoate is CN1CCCC(OC(=O)c2ccccc2Br)C1.
What is the InChIKey of (1-methylpiperidin-3-yl) 2-bromobenzoate?
The InChIKey is MTBWTESSKIGQPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrNO2/c1-15-8-4-5-10(9-15)17-13(16)11-6-2-3-7-12(11)14/h2-3,6-7,10H,4-5,8-9H2,1H3.
What are the key properties of (1-methylpiperidin-3-yl) 2-bromobenzoate?
(1-methylpiperidin-3-yl) 2-bromobenzoate has a molecular weight of 298.18 g/mol, XLogP of 2.70, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpiperidin-3-yl) 2-bromobenzoate is sourced from PubChem (CID 4991215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).