C20H23NO2 — CID 769610
[(3R)-1-methylpiperidin-3-yl] 2,2-diphenylacetate (PubChem CID 769610) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is [(3R)-1-methylpiperidin-3-yl] 2,2-diphenylacetate.
| Compound Name | [(3R)-1-methylpiperidin-3-yl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 769610 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | [(3R)-1-methylpiperidin-3-yl] 2,2-diphenylacetate |
| SMILES | CN1CCC[C@@H](OC(=O)C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C20H23NO2/c1-21-14-8-13-18(15-21)23-20(22)19(16-9-4-2-5-10-16)17-11-6-3-7-12-17/h2-7,9-12,18-19H,8,13-15H2,1H3/t18-/m1/s1 |
| InChIKey | JOOITGNDMHFLJI-GOSISDBHSA-N |
| XLogP | 3.46 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |