C22H28ClNO2 — CID 138400545
(1,2,6-trimethylpiperidin-4-yl) 2,2-diphenylacetate;hydrochloride (PubChem CID 138400545) has the molecular formula C22H28ClNO2 and a molecular weight of 373.92 g/mol. Its IUPAC name is (1,2,6-trimethylpiperidin-4-yl) 2,2-diphenylacetate;hydrochloride.
| Compound Name | (1,2,6-trimethylpiperidin-4-yl) 2,2-diphenylacetate;hydrochloride |
|---|---|
| PubChem CID | 138400545 |
| Molecular Formula | C22H28ClNO2 |
| Molecular Weight | 373.92 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | (1,2,6-trimethylpiperidin-4-yl) 2,2-diphenylacetate;hydrochloride |
| SMILES | CC1CC(OC(=O)C(c2ccccc2)c2ccccc2)CC(C)N1C.Cl |
| InChI | InChI=1S/C22H27NO2.ClH/c1-16-14-20(15-17(2)23(16)3)25-22(24)21(18-10-6-4-7-11-18)19-12-8-5-9-13-19;/h4-13,16-17,20-21H,14-15H2,1-3H3;1H |
| InChIKey | LXYHHQBJIVTGNY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.92 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |