C45H56N2O4+2 — CID 56610032
[1-[5-[4-(2,2-diphenylacetyl)oxy-1-methylpiperidin-1-ium-1-yl]pentyl]-1-methylpiperidin-1-ium-4-yl] 2,2-diphenylacetate (PubChem CID 56610032) has the molecular formula C45H56N2O4+2 and a molecular weight of 688.95 g/mol. Its IUPAC name is [1-[5-[4-(2,2-diphenylacetyl)oxy-1-methylpiperidin-1-ium-1-yl]pentyl]-1-methylpiperidin-1-ium-4-yl] 2,2-diphenylacetate.
| Compound Name | [1-[5-[4-(2,2-diphenylacetyl)oxy-1-methylpiperidin-1-ium-1-yl]pentyl]-1-methylpiperidin-1-ium-4-yl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 56610032 |
| Molecular Formula | C45H56N2O4+2 |
| Molecular Weight | 688.95 g/mol |
| Exact Mass | 688.42 |
| IUPAC Name | [1-[5-[4-(2,2-diphenylacetyl)oxy-1-methylpiperidin-1-ium-1-yl]pentyl]-1-methylpiperidin-1-ium-4-yl] 2,2-diphenylacetate |
| SMILES | C[N+]1(CCCCC[N+]2(C)CCC(OC(=O)C(c3ccccc3)c3ccccc3)CC2)CCC(OC(=O)C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C45H56N2O4/c1-46(32-26-40(27-33-46)50-44(48)42(36-18-8-3-9-19-36)37-20-10-4-11-21-37)30-16-7-17-31-47(2)34-28-41(29-35-47)51-45(49)43(38-22-12-5-13-23-38)39-24-14-6-15-25-39/h3-6,8-15,18-25,40-43H,7,16-17,26-35H2,1-2H3/q+2 |
| InChIKey | MBQWCQHMTGDFOC-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.95 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|