C22H29N2O2+ — CID 91041192
(1,1-dimethylpiperidin-1-ium-4-yl) 3-anilino-2-phenylpropanoate (PubChem CID 91041192) has the molecular formula C22H29N2O2+ and a molecular weight of 353.49 g/mol. Its IUPAC name is (1,1-dimethylpiperidin-1-ium-4-yl) 3-anilino-2-phenylpropanoate.
| Compound Name | (1,1-dimethylpiperidin-1-ium-4-yl) 3-anilino-2-phenylpropanoate |
|---|---|
| PubChem CID | 91041192 |
| Molecular Formula | C22H29N2O2+ |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | (1,1-dimethylpiperidin-1-ium-4-yl) 3-anilino-2-phenylpropanoate |
| SMILES | C[N+]1(C)CCC(OC(=O)C(CNc2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H29N2O2/c1-24(2)15-13-20(14-16-24)26-22(25)21(18-9-5-3-6-10-18)17-23-19-11-7-4-8-12-19/h3-12,20-21,23H,13-17H2,1-2H3/q+1 |
| InChIKey | FUHFBYQPAWMVQJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|