C29H31N4O3+ — CID 88875763
[(3R)-1-methyl-1-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]pyrrolidin-1-ium-3-yl] 3-anilino-2-phenylpropanoate (PubChem CID 88875763) has the molecular formula C29H31N4O3+ and a molecular weight of 483.59 g/mol. Its IUPAC name is [(3R)-1-methyl-1-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]pyrrolidin-1-ium-3-yl] 3-anilino-2-phenylpropanoate.
| Compound Name | [(3R)-1-methyl-1-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]pyrrolidin-1-ium-3-yl] 3-anilino-2-phenylpropanoate |
|---|---|
| PubChem CID | 88875763 |
| Molecular Formula | C29H31N4O3+ |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | [(3R)-1-methyl-1-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]pyrrolidin-1-ium-3-yl] 3-anilino-2-phenylpropanoate |
| SMILES | C[N+]1(Cc2noc(-c3ccccc3)n2)CC[C@@H](OC(=O)C(CNc2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C29H31N4O3/c1-33(21-27-31-28(36-32-27)23-13-7-3-8-14-23)18-17-25(20-33)35-29(34)26(22-11-5-2-6-12-22)19-30-24-15-9-4-10-16-24/h2-16,25-26,30H,17-21H2,1H3/q+1/t25-,26?,33?/m1/s1 |
| InChIKey | LDYAPAUSWQEXPW-YGKSQIIXSA-N |
| XLogP | 4.89 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|