C27H29N2O3+ — CID 75218268
(1-methyl-1-phenacylpyrrolidin-1-ium-3-yl) 2-anilino-2-phenylacetate (PubChem CID 75218268) has the molecular formula C27H29N2O3+ and a molecular weight of 429.54 g/mol. Its IUPAC name is (1-methyl-1-phenacylpyrrolidin-1-ium-3-yl) 2-anilino-2-phenylacetate.
| Compound Name | (1-methyl-1-phenacylpyrrolidin-1-ium-3-yl) 2-anilino-2-phenylacetate |
|---|---|
| PubChem CID | 75218268 |
| Molecular Formula | C27H29N2O3+ |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | (1-methyl-1-phenacylpyrrolidin-1-ium-3-yl) 2-anilino-2-phenylacetate |
| SMILES | C[N+]1(CC(=O)c2ccccc2)CCC(OC(=O)C(Nc2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C27H29N2O3/c1-29(20-25(30)21-11-5-2-6-12-21)18-17-24(19-29)32-27(31)26(22-13-7-3-8-14-22)28-23-15-9-4-10-16-23/h2-16,24,26,28H,17-20H2,1H3/q+1 |
| InChIKey | QKJOPBGSKFMKKP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|