C22H31N2O2+ — CID 157204595
(1,1-dimethylpiperidin-1-ium-4-yl) 2-anilino-2-phenylacetate;methane (PubChem CID 157204595) has the molecular formula C22H31N2O2+ and a molecular weight of 355.50 g/mol. Its IUPAC name is (1,1-dimethylpiperidin-1-ium-4-yl) 2-anilino-2-phenylacetate;methane.
| Compound Name | (1,1-dimethylpiperidin-1-ium-4-yl) 2-anilino-2-phenylacetate;methane |
|---|---|
| PubChem CID | 157204595 |
| Molecular Formula | C22H31N2O2+ |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | (1,1-dimethylpiperidin-1-ium-4-yl) 2-anilino-2-phenylacetate;methane |
| SMILES | C.C[N+]1(C)CCC(OC(=O)C(Nc2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H27N2O2.CH4/c1-23(2)15-13-19(14-16-23)25-21(24)20(17-9-5-3-6-10-17)22-18-11-7-4-8-12-18;/h3-12,19-20,22H,13-16H2,1-2H3;1H4/q+1; |
| InChIKey | AREXPIQCSSTNMB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|