C20H30BrNO3 — CID 66605372
(1,1-dimethylpiperidin-1-ium-4-yl) 2-cyclopentyl-2-(2-hydroxyphenyl)acetate bromide (PubChem CID 66605372) has the molecular formula C20H30BrNO3 and a molecular weight of 412.37 g/mol. Its IUPAC name is (1,1-dimethylpiperidin-1-ium-4-yl) 2-cyclopentyl-2-(2-hydroxyphenyl)acetate bromide.
| Compound Name | (1,1-dimethylpiperidin-1-ium-4-yl) 2-cyclopentyl-2-(2-hydroxyphenyl)acetate bromide |
|---|---|
| PubChem CID | 66605372 |
| Molecular Formula | C20H30BrNO3 |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | (1,1-dimethylpiperidin-1-ium-4-yl) 2-cyclopentyl-2-(2-hydroxyphenyl)acetate bromide |
| SMILES | C[N+]1(C)CCC(OC(=O)C(c2ccccc2O)C2CCCC2)CC1.[Br-] |
| InChI | InChI=1S/C20H29NO3.BrH/c1-21(2)13-11-16(12-14-21)24-20(23)19(15-7-3-4-8-15)17-9-5-6-10-18(17)22;/h5-6,9-10,15-16,19H,3-4,7-8,11-14H2,1-2H3;1H |
| InChIKey | ZRNDXXWYWNDVMB-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|