C20H34NO6S+ — CID 126960149
(1,1-dimethylpiperidin-1-ium-4-yl) 3-methyl-2-phenylpentanoate;methyl hydrogen sulfate (PubChem CID 126960149) has the molecular formula C20H34NO6S+ and a molecular weight of 416.56 g/mol. Its IUPAC name is (1,1-dimethylpiperidin-1-ium-4-yl) 3-methyl-2-phenylpentanoate;methyl hydrogen sulfate.
| Compound Name | (1,1-dimethylpiperidin-1-ium-4-yl) 3-methyl-2-phenylpentanoate;methyl hydrogen sulfate |
|---|---|
| PubChem CID | 126960149 |
| Molecular Formula | C20H34NO6S+ |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | (1,1-dimethylpiperidin-1-ium-4-yl) 3-methyl-2-phenylpentanoate;methyl hydrogen sulfate |
| SMILES | CCC(C)C(C(=O)OC1CC[N+](C)(C)CC1)c1ccccc1.COS(=O)(=O)O |
| InChI | InChI=1S/C19H30NO2.CH4O4S/c1-5-15(2)18(16-9-7-6-8-10-16)19(21)22-17-11-13-20(3,4)14-12-17;1-5-6(2,3)4/h6-10,15,17-18H,5,11-14H2,1-4H3;1H3,(H,2,3,4)/q+1; |
| InChIKey | YGURFDXYQNOJCS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|