C22H39NO2 — CID 143465368
ethane;(1-methylpyrrolidin-3-yl) 3-methyl-2-phenylhexanoate (PubChem CID 143465368) has the molecular formula C22H39NO2 and a molecular weight of 349.56 g/mol. Its IUPAC name is ethane;(1-methylpyrrolidin-3-yl) 3-methyl-2-phenylhexanoate.
| Compound Name | ethane;(1-methylpyrrolidin-3-yl) 3-methyl-2-phenylhexanoate |
|---|---|
| PubChem CID | 143465368 |
| Molecular Formula | C22H39NO2 |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 349.30 |
| IUPAC Name | ethane;(1-methylpyrrolidin-3-yl) 3-methyl-2-phenylhexanoate |
| SMILES | CC.CC.CCCC(C)C(C(=O)OC1CCN(C)C1)c1ccccc1 |
| InChI | InChI=1S/C18H27NO2.2C2H6/c1-4-8-14(2)17(15-9-6-5-7-10-15)18(20)21-16-11-12-19(3)13-16;2*1-2/h5-7,9-10,14,16-17H,4,8,11-13H2,1-3H3;2*1-2H3 |
| InChIKey | ANETWYQEGZGRMG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |