C20H31NO2 — CID 139477179
1-[(2R)-4-(methoxymethyl)-2-methylpyrrolidin-1-yl]-3-methyl-2-phenylhexan-1-one (PubChem CID 139477179) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is 1-[(2R)-4-(methoxymethyl)-2-methylpyrrolidin-1-yl]-3-methyl-2-phenylhexan-1-one.
| Compound Name | 1-[(2R)-4-(methoxymethyl)-2-methylpyrrolidin-1-yl]-3-methyl-2-phenylhexan-1-one |
|---|---|
| PubChem CID | 139477179 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | 1-[(2R)-4-(methoxymethyl)-2-methylpyrrolidin-1-yl]-3-methyl-2-phenylhexan-1-one |
| SMILES | CCCC(C)C(C(=O)N1CC(COC)C[C@H]1C)c1ccccc1 |
| InChI | InChI=1S/C20H31NO2/c1-5-9-15(2)19(18-10-7-6-8-11-18)20(22)21-13-17(14-23-4)12-16(21)3/h6-8,10-11,15-17,19H,5,9,12-14H2,1-4H3/t15?,16-,17?,19?/m1/s1 |
| InChIKey | HXBKKAZPIRTORF-DSICWQNTSA-N |
| XLogP | 4.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |