About 1-ethyl-1-methylpiperidin-1-ium-4-ol;3-methyl-2-phenylpentanoate;hydrobromide
1-ethyl-1-methylpiperidin-1-ium-4-ol;3-methyl-2-phenylpentanoate;hydrobromide (PubChem CID 21151667) has the molecular formula C20H34BrNO3
and a molecular weight of 416.40 g/mol. Its IUPAC name is 1-ethyl-1-methylpiperidin-1-ium-4-ol;3-methyl-2-phenylpentanoate;hydrobromide.
Molecular Properties
| Compound Name | 1-ethyl-1-methylpiperidin-1-ium-4-ol;3-methyl-2-phenylpentanoate;hydrobromide |
| PubChem CID | 21151667 |
| Molecular Formula | C20H34BrNO3 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 1-ethyl-1-methylpiperidin-1-ium-4-ol;3-methyl-2-phenylpentanoate;hydrobromide |
| SMILES | Br.CCC(C)C(C(=O)[O-])c1ccccc1.CC[N+]1(C)CCC(O)CC1 |
| InChI | InChI=1S/C12H16O2.C8H18NO.BrH/c1-3-9(2)11(12(13)14)10-7-5-4-6-8-10;1-3-9(2)6-4-8(10)5-7-9;/h4-9,11H,3H2,1-2H3,(H,13,14);8,10H,3-7H2,1-2H3;1H/q;+1;/p-1 |
| InChIKey | OCZMMSSTMWBYLV-UHFFFAOYSA-M |
| XLogP | 2.75 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-1-methylpiperidin-1-ium-4-ol;3-methyl-2-phenylpentanoate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-1-methylpiperidin-1-ium-4-ol;3-methyl-2-phenylpentanoate;hydrobromide?
The IUPAC name of 1-ethyl-1-methylpiperidin-1-ium-4-ol;3-methyl-2-phenylpentanoate;hydrobromide (CID 21151667) is 1-ethyl-1-methylpiperidin-1-ium-4-ol;3-methyl-2-phenylpentanoate;hydrobromide.
What is the SMILES notation for 1-ethyl-1-methylpiperidin-1-ium-4-ol;3-methyl-2-phenylpentanoate;hydrobromide?
The canonical SMILES for 1-ethyl-1-methylpiperidin-1-ium-4-ol;3-methyl-2-phenylpentanoate;hydrobromide is Br.CCC(C)C(C(=O)[O-])c1ccccc1.CC[N+]1(C)CCC(O)CC1.
What is the InChIKey of 1-ethyl-1-methylpiperidin-1-ium-4-ol;3-methyl-2-phenylpentanoate;hydrobromide?
The InChIKey is OCZMMSSTMWBYLV-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H16O2.C8H18NO.BrH/c1-3-9(2)11(12(13)14)10-7-5-4-6-8-10;1-3-9(2)6-4-8(10)5-7-9;/h4-9,11H,3H2,1-2H3,(H,13,14);8,10H,3-7H2,1-2H3;1H/q;+1;/p-1.
What are the key properties of 1-ethyl-1-methylpiperidin-1-ium-4-ol;3-methyl-2-phenylpentanoate;hydrobromide?
1-ethyl-1-methylpiperidin-1-ium-4-ol;3-methyl-2-phenylpentanoate;hydrobromide has a molecular weight of 416.40 g/mol, XLogP of 2.75, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1-methylpiperidin-1-ium-4-ol;3-methyl-2-phenylpentanoate;hydrobromide is sourced from PubChem (CID 21151667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).