C18H27NO2 — CID 104957118
N-[(1S,2S)-2-hydroxycyclohexyl]-3-methyl-2-phenylpentanamide (PubChem CID 104957118) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is N-[(1S,2S)-2-hydroxycyclohexyl]-3-methyl-2-phenylpentanamide.
| Compound Name | N-[(1S,2S)-2-hydroxycyclohexyl]-3-methyl-2-phenylpentanamide |
|---|---|
| PubChem CID | 104957118 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | N-[(1S,2S)-2-hydroxycyclohexyl]-3-methyl-2-phenylpentanamide |
| SMILES | CCC(C)C(C(=O)N[C@H]1CCCC[C@@H]1O)c1ccccc1 |
| InChI | InChI=1S/C18H27NO2/c1-3-13(2)17(14-9-5-4-6-10-14)18(21)19-15-11-7-8-12-16(15)20/h4-6,9-10,13,15-17,20H,3,7-8,11-12H2,1-2H3,(H,19,21)/t13?,15-,16-,17?/m0/s1 |
| InChIKey | WPXBNFFCCJKIJN-DBGUYSSFSA-N |
| XLogP | 3.24 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |