C19H33BrNO3- — CID 23616347
diethyl-(2-hydroxyethyl)-methylazanium;3-methyl-2-phenylpentanoate;bromide (PubChem CID 23616347) has the molecular formula C19H33BrNO3- and a molecular weight of 403.38 g/mol. Its IUPAC name is diethyl-(2-hydroxyethyl)-methylazanium;3-methyl-2-phenylpentanoate;bromide.
| Compound Name | diethyl-(2-hydroxyethyl)-methylazanium;3-methyl-2-phenylpentanoate;bromide |
|---|---|
| PubChem CID | 23616347 |
| Molecular Formula | C19H33BrNO3- |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | diethyl-(2-hydroxyethyl)-methylazanium;3-methyl-2-phenylpentanoate;bromide |
| SMILES | CCC(C)C(C(=O)[O-])c1ccccc1.CC[N+](C)(CC)CCO.[Br-] |
| InChI | InChI=1S/C12H16O2.C7H18NO.BrH/c1-3-9(2)11(12(13)14)10-7-5-4-6-8-10;1-4-8(3,5-2)6-7-9;/h4-9,11H,3H2,1-2H3,(H,13,14);9H,4-7H2,1-3H3;1H/q;+1;/p-2 |
| InChIKey | SABILKMRIMEVNT-UHFFFAOYSA-L |
| XLogP | -0.96 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|