C20H33INO3- — CID 23622277
diethyl-(2-hydroxyethyl)-methylazanium;1-phenylcyclohexane-1-carboxylate;iodide (PubChem CID 23622277) has the molecular formula C20H33INO3- and a molecular weight of 462.39 g/mol. Its IUPAC name is diethyl-(2-hydroxyethyl)-methylazanium;1-phenylcyclohexane-1-carboxylate;iodide.
| Compound Name | diethyl-(2-hydroxyethyl)-methylazanium;1-phenylcyclohexane-1-carboxylate;iodide |
|---|---|
| PubChem CID | 23622277 |
| Molecular Formula | C20H33INO3- |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | diethyl-(2-hydroxyethyl)-methylazanium;1-phenylcyclohexane-1-carboxylate;iodide |
| SMILES | CC[N+](C)(CC)CCO.O=C([O-])C1(c2ccccc2)CCCCC1.[I-] |
| InChI | InChI=1S/C13H16O2.C7H18NO.HI/c14-12(15)13(9-5-2-6-10-13)11-7-3-1-4-8-11;1-4-8(3,5-2)6-7-9;/h1,3-4,7-8H,2,5-6,9-10H2,(H,14,15);9H,4-7H2,1-3H3;1H/q;+1;/p-2 |
| InChIKey | GFBXIEOBJMHHRP-UHFFFAOYSA-L |
| XLogP | -0.89 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|