C12H12FO2- — CID 6931371
1-(4-fluorophenyl)cyclopentane-1-carboxylate (PubChem CID 6931371) has the molecular formula C12H12FO2- and a molecular weight of 207.22 g/mol. Its IUPAC name is 1-(4-fluorophenyl)cyclopentane-1-carboxylate.
| Compound Name | 1-(4-fluorophenyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 6931371 |
| Molecular Formula | C12H12FO2- |
| Molecular Weight | 207.22 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 1-(4-fluorophenyl)cyclopentane-1-carboxylate |
| SMILES | O=C([O-])C1(c2ccc(F)cc2)CCCC1 |
| InChI | InChI=1S/C12H13FO2/c13-10-5-3-9(4-6-10)12(11(14)15)7-1-2-8-12/h3-6H,1-2,7-8H2,(H,14,15)/p-1 |
| InChIKey | VVMRZYODYMBLRJ-UHFFFAOYSA-M |
| XLogP | 1.39 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |