C12H12ClO2- — CID 26365664
1-(3-chlorophenyl)cyclopentane-1-carboxylate (PubChem CID 26365664) has the molecular formula C12H12ClO2- and a molecular weight of 223.68 g/mol. Its IUPAC name is 1-(3-chlorophenyl)cyclopentane-1-carboxylate.
| Compound Name | 1-(3-chlorophenyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 26365664 |
| Molecular Formula | C12H12ClO2- |
| Molecular Weight | 223.68 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 1-(3-chlorophenyl)cyclopentane-1-carboxylate |
| SMILES | O=C([O-])C1(c2cccc(Cl)c2)CCCC1 |
| InChI | InChI=1S/C12H13ClO2/c13-10-5-3-4-9(8-10)12(11(14)15)6-1-2-7-12/h3-5,8H,1-2,6-7H2,(H,14,15)/p-1 |
| InChIKey | GGEPQYZXKVJSEX-UHFFFAOYSA-M |
| XLogP | 1.90 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.68 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |