C17H18ClN3O2 — CID 78872634
N'-[1-(3-chlorophenyl)cyclopentanecarbonyl]-1H-pyrrole-2-carbohydrazide (PubChem CID 78872634) has the molecular formula C17H18ClN3O2 and a molecular weight of 331.80 g/mol. Its IUPAC name is N'-[1-(3-chlorophenyl)cyclopentanecarbonyl]-1H-pyrrole-2-carbohydrazide.
| Compound Name | N'-[1-(3-chlorophenyl)cyclopentanecarbonyl]-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 78872634 |
| Molecular Formula | C17H18ClN3O2 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | N'-[1-(3-chlorophenyl)cyclopentanecarbonyl]-1H-pyrrole-2-carbohydrazide |
| SMILES | O=C(NNC(=O)C1(c2cccc(Cl)c2)CCCC1)c1ccc[nH]1 |
| InChI | InChI=1S/C17H18ClN3O2/c18-13-6-3-5-12(11-13)17(8-1-2-9-17)16(23)21-20-15(22)14-7-4-10-19-14/h3-7,10-11,19H,1-2,8-9H2,(H,20,22)(H,21,23) |
| InChIKey | OZNSUBOQOHUIDS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|