C18H26Cl2N2O — CID 119478308
N-(4-aminocyclohexyl)-1-(3-chlorophenyl)cyclopentane-1-carboxamide;hydrochloride (PubChem CID 119478308) has the molecular formula C18H26Cl2N2O and a molecular weight of 357.33 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-1-(3-chlorophenyl)cyclopentane-1-carboxamide;hydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-1-(3-chlorophenyl)cyclopentane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119478308 |
| Molecular Formula | C18H26Cl2N2O |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | N-(4-aminocyclohexyl)-1-(3-chlorophenyl)cyclopentane-1-carboxamide;hydrochloride |
| SMILES | Cl.NC1CCC(NC(=O)C2(c3cccc(Cl)c3)CCCC2)CC1 |
| InChI | InChI=1S/C18H25ClN2O.ClH/c19-14-5-3-4-13(12-14)18(10-1-2-11-18)17(22)21-16-8-6-15(20)7-9-16;/h3-5,12,15-16H,1-2,6-11,20H2,(H,21,22);1H |
| InChIKey | DHSDPEBUIPYXIQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |