C21H29ClN2O3 — CID 52731131
tert-butyl 4-[[1-(3-chlorophenyl)cyclobutanecarbonyl]amino]piperidine-1-carboxylate (PubChem CID 52731131) has the molecular formula C21H29ClN2O3 and a molecular weight of 392.93 g/mol. Its IUPAC name is tert-butyl 4-[[1-(3-chlorophenyl)cyclobutanecarbonyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[1-(3-chlorophenyl)cyclobutanecarbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 52731131 |
| Molecular Formula | C21H29ClN2O3 |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | tert-butyl 4-[[1-(3-chlorophenyl)cyclobutanecarbonyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)C2(c3cccc(Cl)c3)CCC2)CC1 |
| InChI | InChI=1S/C21H29ClN2O3/c1-20(2,3)27-19(26)24-12-8-17(9-13-24)23-18(25)21(10-5-11-21)15-6-4-7-16(22)14-15/h4,6-7,14,17H,5,8-13H2,1-3H3,(H,23,25) |
| InChIKey | QTDWYRAIWVGRCG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |