C18H24ClNO3 — CID 68676536
tert-butyl 4-[2-(3-chlorophenyl)-2-oxoethyl]piperidine-1-carboxylate (PubChem CID 68676536) has the molecular formula C18H24ClNO3 and a molecular weight of 337.85 g/mol. Its IUPAC name is tert-butyl 4-[2-(3-chlorophenyl)-2-oxoethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(3-chlorophenyl)-2-oxoethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68676536 |
| Molecular Formula | C18H24ClNO3 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | tert-butyl 4-[2-(3-chlorophenyl)-2-oxoethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC(=O)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C18H24ClNO3/c1-18(2,3)23-17(22)20-9-7-13(8-10-20)11-16(21)14-5-4-6-15(19)12-14/h4-6,12-13H,7-11H2,1-3H3 |
| InChIKey | JKMZCWWWGDGWPH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |