C17H25ClN2O2S — CID 146340530
tert-butyl 4-[(3-chlorophenyl)methylsulfanylamino]piperidine-1-carboxylate (PubChem CID 146340530) has the molecular formula C17H25ClN2O2S and a molecular weight of 356.92 g/mol. Its IUPAC name is tert-butyl 4-[(3-chlorophenyl)methylsulfanylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3-chlorophenyl)methylsulfanylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 146340530 |
| Molecular Formula | C17H25ClN2O2S |
| Molecular Weight | 356.92 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | tert-butyl 4-[(3-chlorophenyl)methylsulfanylamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NSCc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H25ClN2O2S/c1-17(2,3)22-16(21)20-9-7-15(8-10-20)19-23-12-13-5-4-6-14(18)11-13/h4-6,11,15,19H,7-10,12H2,1-3H3 |
| InChIKey | AWWXBJCQYDJNPR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.92 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|