C22H31ClN2O3 — CID 52731080
tert-butyl 4-[[1-(3-chlorophenyl)cyclopentanecarbonyl]amino]piperidine-1-carboxylate (PubChem CID 52731080) has the molecular formula C22H31ClN2O3 and a molecular weight of 406.95 g/mol. Its IUPAC name is tert-butyl 4-[[1-(3-chlorophenyl)cyclopentanecarbonyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[1-(3-chlorophenyl)cyclopentanecarbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 52731080 |
| Molecular Formula | C22H31ClN2O3 |
| Molecular Weight | 406.95 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | tert-butyl 4-[[1-(3-chlorophenyl)cyclopentanecarbonyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)C2(c3cccc(Cl)c3)CCCC2)CC1 |
| InChI | InChI=1S/C22H31ClN2O3/c1-21(2,3)28-20(27)25-13-9-18(10-14-25)24-19(26)22(11-4-5-12-22)16-7-6-8-17(23)15-16/h6-8,15,18H,4-5,9-14H2,1-3H3,(H,24,26) |
| InChIKey | WFHMVPOBCPZICN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.95 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |