C16H22Cl2N2O — CID 119474559
N-(4-aminocyclohexyl)-1-(3-chlorophenyl)cyclopropane-1-carboxamide;hydrochloride (PubChem CID 119474559) has the molecular formula C16H22Cl2N2O and a molecular weight of 329.27 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-1-(3-chlorophenyl)cyclopropane-1-carboxamide;hydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-1-(3-chlorophenyl)cyclopropane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119474559 |
| Molecular Formula | C16H22Cl2N2O |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | N-(4-aminocyclohexyl)-1-(3-chlorophenyl)cyclopropane-1-carboxamide;hydrochloride |
| SMILES | Cl.NC1CCC(NC(=O)C2(c3cccc(Cl)c3)CC2)CC1 |
| InChI | InChI=1S/C16H21ClN2O.ClH/c17-12-3-1-2-11(10-12)16(8-9-16)15(20)19-14-6-4-13(18)5-7-14;/h1-3,10,13-14H,4-9,18H2,(H,19,20);1H |
| InChIKey | HMFJRUPSLPRTME-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |