C19H25ClN2O2 — CID 119459119
N-(8-azabicyclo[3.2.1]octan-3-yl)-4-(3-chlorophenyl)oxane-4-carboxamide (PubChem CID 119459119) has the molecular formula C19H25ClN2O2 and a molecular weight of 348.87 g/mol. Its IUPAC name is N-(8-azabicyclo[3.2.1]octan-3-yl)-4-(3-chlorophenyl)oxane-4-carboxamide.
| Compound Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-4-(3-chlorophenyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 119459119 |
| Molecular Formula | C19H25ClN2O2 |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-4-(3-chlorophenyl)oxane-4-carboxamide |
| SMILES | O=C(NC1CC2CCC(C1)N2)C1(c2cccc(Cl)c2)CCOCC1 |
| InChI | InChI=1S/C19H25ClN2O2/c20-14-3-1-2-13(10-14)19(6-8-24-9-7-19)18(23)22-17-11-15-4-5-16(12-17)21-15/h1-3,10,15-17,21H,4-9,11-12H2,(H,22,23) |
| InChIKey | DEBGUYXXKJHHGI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |