C20H27BrN2O — CID 119457804
N-(8-azabicyclo[3.2.1]octan-3-yl)-1-(3-bromophenyl)cyclohexane-1-carboxamide (PubChem CID 119457804) has the molecular formula C20H27BrN2O and a molecular weight of 391.35 g/mol. Its IUPAC name is N-(8-azabicyclo[3.2.1]octan-3-yl)-1-(3-bromophenyl)cyclohexane-1-carboxamide.
| Compound Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-1-(3-bromophenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119457804 |
| Molecular Formula | C20H27BrN2O |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-1-(3-bromophenyl)cyclohexane-1-carboxamide |
| SMILES | O=C(NC1CC2CCC(C1)N2)C1(c2cccc(Br)c2)CCCCC1 |
| InChI | InChI=1S/C20H27BrN2O/c21-15-6-4-5-14(11-15)20(9-2-1-3-10-20)19(24)23-18-12-16-7-8-17(13-18)22-16/h4-6,11,16-18,22H,1-3,7-10,12-13H2,(H,23,24) |
| InChIKey | BNEHOHHGMIOHEU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |