C21H29ClN2O — CID 56568898
1-(3-chlorophenyl)-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]cyclobutane-1-carboxamide (PubChem CID 56568898) has the molecular formula C21H29ClN2O and a molecular weight of 360.93 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]cyclobutane-1-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 56568898 |
| Molecular Formula | C21H29ClN2O |
| Molecular Weight | 360.93 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 1-(3-chlorophenyl)-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]cyclobutane-1-carboxamide |
| SMILES | CC(C)=CCN1CCC(NC(=O)C2(c3cccc(Cl)c3)CCC2)CC1 |
| InChI | InChI=1S/C21H29ClN2O/c1-16(2)7-12-24-13-8-19(9-14-24)23-20(25)21(10-4-11-21)17-5-3-6-18(22)15-17/h3,5-7,15,19H,4,8-14H2,1-2H3,(H,23,25) |
| InChIKey | ZTZMJACLCLKLLX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.93 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|