C17H23FN2O3S — CID 75479820
1-(4-fluorophenyl)-N-piperidin-1-ylsulfonylcyclopentane-1-carboxamide (PubChem CID 75479820) has the molecular formula C17H23FN2O3S and a molecular weight of 354.45 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-piperidin-1-ylsulfonylcyclopentane-1-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-piperidin-1-ylsulfonylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 75479820 |
| Molecular Formula | C17H23FN2O3S |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 1-(4-fluorophenyl)-N-piperidin-1-ylsulfonylcyclopentane-1-carboxamide |
| SMILES | O=C(NS(=O)(=O)N1CCCCC1)C1(c2ccc(F)cc2)CCCC1 |
| InChI | InChI=1S/C17H23FN2O3S/c18-15-8-6-14(7-9-15)17(10-2-3-11-17)16(21)19-24(22,23)20-12-4-1-5-13-20/h6-9H,1-5,10-13H2,(H,19,21) |
| InChIKey | SZTHTVVRZQIHDY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |