C21H23FN2O3S — CID 46561290
[4-(benzenesulfonyl)piperazin-1-yl]-[1-(4-fluorophenyl)cyclobutyl]methanone (PubChem CID 46561290) has the molecular formula C21H23FN2O3S and a molecular weight of 402.49 g/mol. Its IUPAC name is [4-(benzenesulfonyl)piperazin-1-yl]-[1-(4-fluorophenyl)cyclobutyl]methanone.
| Compound Name | [4-(benzenesulfonyl)piperazin-1-yl]-[1-(4-fluorophenyl)cyclobutyl]methanone |
|---|---|
| PubChem CID | 46561290 |
| Molecular Formula | C21H23FN2O3S |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | [4-(benzenesulfonyl)piperazin-1-yl]-[1-(4-fluorophenyl)cyclobutyl]methanone |
| SMILES | O=C(N1CCN(S(=O)(=O)c2ccccc2)CC1)C1(c2ccc(F)cc2)CCC1 |
| InChI | InChI=1S/C21H23FN2O3S/c22-18-9-7-17(8-10-18)21(11-4-12-21)20(25)23-13-15-24(16-14-23)28(26,27)19-5-2-1-3-6-19/h1-3,5-10H,4,11-16H2 |
| InChIKey | ZVTDVHGCEZVBCU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |