C16H23N3O3S — CID 119265347
(1-aminocyclopentyl)-[4-(benzenesulfonyl)piperazin-1-yl]methanone (PubChem CID 119265347) has the molecular formula C16H23N3O3S and a molecular weight of 337.44 g/mol. Its IUPAC name is (1-aminocyclopentyl)-[4-(benzenesulfonyl)piperazin-1-yl]methanone.
| Compound Name | (1-aminocyclopentyl)-[4-(benzenesulfonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 119265347 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | (1-aminocyclopentyl)-[4-(benzenesulfonyl)piperazin-1-yl]methanone |
| SMILES | NC1(C(=O)N2CCN(S(=O)(=O)c3ccccc3)CC2)CCCC1 |
| InChI | InChI=1S/C16H23N3O3S/c17-16(8-4-5-9-16)15(20)18-10-12-19(13-11-18)23(21,22)14-6-2-1-3-7-14/h1-3,6-7H,4-5,8-13,17H2 |
| InChIKey | WWFROSMPFCQGQO-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |