C18H27N3O3S — CID 119302953
(1-aminocyclohexyl)-[4-(benzenesulfonyl)-1,4-diazepan-1-yl]methanone (PubChem CID 119302953) has the molecular formula C18H27N3O3S and a molecular weight of 365.50 g/mol. Its IUPAC name is (1-aminocyclohexyl)-[4-(benzenesulfonyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | (1-aminocyclohexyl)-[4-(benzenesulfonyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 119302953 |
| Molecular Formula | C18H27N3O3S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | (1-aminocyclohexyl)-[4-(benzenesulfonyl)-1,4-diazepan-1-yl]methanone |
| SMILES | NC1(C(=O)N2CCCN(S(=O)(=O)c3ccccc3)CC2)CCCCC1 |
| InChI | InChI=1S/C18H27N3O3S/c19-18(10-5-2-6-11-18)17(22)20-12-7-13-21(15-14-20)25(23,24)16-8-3-1-4-9-16/h1,3-4,8-9H,2,5-7,10-15,19H2 |
| InChIKey | JQOPBNRZSTUTDV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |