C17H26ClN3O4S — CID 119265567
(1-aminocyclopentyl)-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methanone;hydrochloride (PubChem CID 119265567) has the molecular formula C17H26ClN3O4S and a molecular weight of 403.93 g/mol. Its IUPAC name is (1-aminocyclopentyl)-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methanone;hydrochloride.
| Compound Name | (1-aminocyclopentyl)-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119265567 |
| Molecular Formula | C17H26ClN3O4S |
| Molecular Weight | 403.93 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | (1-aminocyclopentyl)-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]methanone;hydrochloride |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C(=O)C3(N)CCCC3)CC2)cc1.Cl |
| InChI | InChI=1S/C17H25N3O4S.ClH/c1-24-14-4-6-15(7-5-14)25(22,23)20-12-10-19(11-13-20)16(21)17(18)8-2-3-9-17;/h4-7H,2-3,8-13,18H2,1H3;1H |
| InChIKey | ZYYFZNOFXNDNJM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.93 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |