C16H22FN3O3S — CID 119265625
(1-aminocyclopentyl)-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 119265625) has the molecular formula C16H22FN3O3S and a molecular weight of 355.44 g/mol. Its IUPAC name is (1-aminocyclopentyl)-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (1-aminocyclopentyl)-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 119265625 |
| Molecular Formula | C16H22FN3O3S |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | (1-aminocyclopentyl)-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | NC1(C(=O)N2CCN(S(=O)(=O)c3ccc(F)cc3)CC2)CCCC1 |
| InChI | InChI=1S/C16H22FN3O3S/c17-13-3-5-14(6-4-13)24(22,23)20-11-9-19(10-12-20)15(21)16(18)7-1-2-8-16/h3-6H,1-2,7-12,18H2 |
| InChIKey | URCZUSJSMJESMP-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |