C17H26ClNO2 — CID 163331456
trimethyl-[2-(1-phenylcyclopentanecarbonyl)oxyethyl]azanium chloride (PubChem CID 163331456) has the molecular formula C17H26ClNO2 and a molecular weight of 311.85 g/mol. Its IUPAC name is trimethyl-[2-(1-phenylcyclopentanecarbonyl)oxyethyl]azanium chloride.
| Compound Name | trimethyl-[2-(1-phenylcyclopentanecarbonyl)oxyethyl]azanium chloride |
|---|---|
| PubChem CID | 163331456 |
| Molecular Formula | C17H26ClNO2 |
| Molecular Weight | 311.85 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | trimethyl-[2-(1-phenylcyclopentanecarbonyl)oxyethyl]azanium chloride |
| SMILES | C[N+](C)(C)CCOC(=O)C1(c2ccccc2)CCCC1.[Cl-] |
| InChI | InChI=1S/C17H26NO2.ClH/c1-18(2,3)13-14-20-16(19)17(11-7-8-12-17)15-9-5-4-6-10-15;/h4-6,9-10H,7-8,11-14H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | VGWJSZSULMPSBX-UHFFFAOYSA-M |
| XLogP | -0.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.85 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|