C34H52N2O8S — CID 162394226
bis(ethyl-[2-(1-phenylcyclohexanecarbonyl)oxyethyl]azanium);sulfate (PubChem CID 162394226) has the molecular formula C34H52N2O8S and a molecular weight of 648.86 g/mol. Its IUPAC name is bis(ethyl-[2-(1-phenylcyclohexanecarbonyl)oxyethyl]azanium);sulfate.
| Compound Name | bis(ethyl-[2-(1-phenylcyclohexanecarbonyl)oxyethyl]azanium);sulfate |
|---|---|
| PubChem CID | 162394226 |
| Molecular Formula | C34H52N2O8S |
| Molecular Weight | 648.86 g/mol |
| Exact Mass | 648.34 |
| IUPAC Name | bis(ethyl-[2-(1-phenylcyclohexanecarbonyl)oxyethyl]azanium);sulfate |
| SMILES | CC[NH2+]CCOC(=O)C1(c2ccccc2)CCCCC1.CC[NH2+]CCOC(=O)C1(c2ccccc2)CCCCC1.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C17H25NO2.H2O4S/c2*1-2-18-13-14-20-16(19)17(11-7-4-8-12-17)15-9-5-3-6-10-15;1-5(2,3)4/h2*3,5-6,9-10,18H,2,4,7-8,11-14H2,1H3;(H2,1,2,3,4) |
| InChIKey | RNVSUZTUGYNYBK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 166.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.86 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|