C16H23ClNO2- — CID 53312763
2-(dimethylamino)ethyl 1-phenylcyclopentane-1-carboxylate chloride (PubChem CID 53312763) has the molecular formula C16H23ClNO2- and a molecular weight of 296.82 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 1-phenylcyclopentane-1-carboxylate chloride.
| Compound Name | 2-(dimethylamino)ethyl 1-phenylcyclopentane-1-carboxylate chloride |
|---|---|
| PubChem CID | 53312763 |
| Molecular Formula | C16H23ClNO2- |
| Molecular Weight | 296.82 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-(dimethylamino)ethyl 1-phenylcyclopentane-1-carboxylate chloride |
| SMILES | CN(C)CCOC(=O)C1(c2ccccc2)CCCC1.[Cl-] |
| InChI | InChI=1S/C16H23NO2.ClH/c1-17(2)12-13-19-15(18)16(10-6-7-11-16)14-8-4-3-5-9-14;/h3-5,8-9H,6-7,10-13H2,1-2H3;1H/p-1 |
| InChIKey | PGHDZDJZLPPKDZ-UHFFFAOYSA-M |
| XLogP | -0.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.82 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |