C21H34ClNO4 — CID 67678429
2-(diethylamino)ethyl 1-phenylcyclopentane-1-carboxylate;methyl acetate;hydrochloride (PubChem CID 67678429) has the molecular formula C21H34ClNO4 and a molecular weight of 399.96 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 1-phenylcyclopentane-1-carboxylate;methyl acetate;hydrochloride.
| Compound Name | 2-(diethylamino)ethyl 1-phenylcyclopentane-1-carboxylate;methyl acetate;hydrochloride |
|---|---|
| PubChem CID | 67678429 |
| Molecular Formula | C21H34ClNO4 |
| Molecular Weight | 399.96 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 2-(diethylamino)ethyl 1-phenylcyclopentane-1-carboxylate;methyl acetate;hydrochloride |
| SMILES | CCN(CC)CCOC(=O)C1(c2ccccc2)CCCC1.COC(C)=O.Cl |
| InChI | InChI=1S/C18H27NO2.C3H6O2.ClH/c1-3-19(4-2)14-15-21-17(20)18(12-8-9-13-18)16-10-6-5-7-11-16;1-3(4)5-2;/h5-7,10-11H,3-4,8-9,12-15H2,1-2H3;1-2H3;1H |
| InChIKey | QKSRXIYIFVJVHX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.96 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |