C17H25ClNO3- — CID 45114073
2-(dimethylamino)ethyl 2-(1-hydroxycyclopentyl)-2-phenylacetate chloride (PubChem CID 45114073) has the molecular formula C17H25ClNO3- and a molecular weight of 326.84 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-(1-hydroxycyclopentyl)-2-phenylacetate chloride.
| Compound Name | 2-(dimethylamino)ethyl 2-(1-hydroxycyclopentyl)-2-phenylacetate chloride |
|---|---|
| PubChem CID | 45114073 |
| Molecular Formula | C17H25ClNO3- |
| Molecular Weight | 326.84 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-(1-hydroxycyclopentyl)-2-phenylacetate chloride |
| SMILES | CN(C)CCOC(=O)C(c1ccccc1)C1(O)CCCC1.[Cl-] |
| InChI | InChI=1S/C17H25NO3.ClH/c1-18(2)12-13-21-16(19)15(14-8-4-3-5-9-14)17(20)10-6-7-11-17;/h3-5,8-9,15,20H,6-7,10-13H2,1-2H3;1H/p-1 |
| InChIKey | RHKZVMUBMXGOLL-UHFFFAOYSA-M |
| XLogP | -0.82 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.84 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |