C22H36BrNO3 — CID 24833082
diethyl-[2-[2-(1-hydroxy-2-methylcyclohexyl)-2-phenylacetyl]oxyethyl]-methylazanium bromide (PubChem CID 24833082) has the molecular formula C22H36BrNO3 and a molecular weight of 442.44 g/mol. Its IUPAC name is diethyl-[2-[2-(1-hydroxy-2-methylcyclohexyl)-2-phenylacetyl]oxyethyl]-methylazanium bromide.
| Compound Name | diethyl-[2-[2-(1-hydroxy-2-methylcyclohexyl)-2-phenylacetyl]oxyethyl]-methylazanium bromide |
|---|---|
| PubChem CID | 24833082 |
| Molecular Formula | C22H36BrNO3 |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | diethyl-[2-[2-(1-hydroxy-2-methylcyclohexyl)-2-phenylacetyl]oxyethyl]-methylazanium bromide |
| SMILES | CC[N+](C)(CC)CCOC(=O)C(c1ccccc1)C1(O)CCCCC1C.[Br-] |
| InChI | InChI=1S/C22H36NO3.BrH/c1-5-23(4,6-2)16-17-26-21(24)20(19-13-8-7-9-14-19)22(25)15-11-10-12-18(22)3;/h7-9,13-14,18,20,25H,5-6,10-12,15-17H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | WXSMDQDTNLFRFQ-UHFFFAOYSA-M |
| XLogP | 0.75 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|