C20H25NO3 — CID 134828224
2-(2,2-diphenylacetyl)oxy-N,N-diethylethanamine oxide (PubChem CID 134828224) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is 2-(2,2-diphenylacetyl)oxy-N,N-diethylethanamine oxide.
| Compound Name | 2-(2,2-diphenylacetyl)oxy-N,N-diethylethanamine oxide |
|---|---|
| PubChem CID | 134828224 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 2-(2,2-diphenylacetyl)oxy-N,N-diethylethanamine oxide |
| SMILES | CC[N+]([O-])(CC)CCOC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H25NO3/c1-3-21(23,4-2)15-16-24-20(22)19(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,19H,3-4,15-16H2,1-2H3 |
| InChIKey | NGELGXXFBUQOGD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|