C18H22NO2+ — CID 3553500
2-(2,2-diphenylacetyl)oxyethyl-dimethylazanium (PubChem CID 3553500) has the molecular formula C18H22NO2+ and a molecular weight of 284.38 g/mol. Its IUPAC name is 2-(2,2-diphenylacetyl)oxyethyl-dimethylazanium.
| Compound Name | 2-(2,2-diphenylacetyl)oxyethyl-dimethylazanium |
|---|---|
| PubChem CID | 3553500 |
| Molecular Formula | C18H22NO2+ |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 2-(2,2-diphenylacetyl)oxyethyl-dimethylazanium |
| SMILES | C[NH+](C)CCOC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H21NO2/c1-19(2)13-14-21-18(20)17(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,17H,13-14H2,1-2H3/p+1 |
| InChIKey | DUHVHRGNHUTXDR-UHFFFAOYSA-O |
| XLogP | 1.51 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |