C19H24ClNO2 — CID 44658693
2-(2,2-diphenylpropanoyloxy)ethyl-dimethylazanium chloride (PubChem CID 44658693) has the molecular formula C19H24ClNO2 and a molecular weight of 333.86 g/mol. Its IUPAC name is 2-(2,2-diphenylpropanoyloxy)ethyl-dimethylazanium chloride.
| Compound Name | 2-(2,2-diphenylpropanoyloxy)ethyl-dimethylazanium chloride |
|---|---|
| PubChem CID | 44658693 |
| Molecular Formula | C19H24ClNO2 |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 2-(2,2-diphenylpropanoyloxy)ethyl-dimethylazanium chloride |
| SMILES | C[NH+](C)CCOC(=O)C(C)(c1ccccc1)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C19H23NO2.ClH/c1-19(16-10-6-4-7-11-16,17-12-8-5-9-13-17)18(21)22-15-14-20(2)3;/h4-13H,14-15H2,1-3H3;1H |
| InChIKey | HOOVEDKSNKVJAX-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |