C20H26NO2+ — CID 21299458
2-(2,2-diphenylpropanoyloxy)ethyl-trimethylazanium (PubChem CID 21299458) has the molecular formula C20H26NO2+ and a molecular weight of 312.43 g/mol. Its IUPAC name is 2-(2,2-diphenylpropanoyloxy)ethyl-trimethylazanium.
| Compound Name | 2-(2,2-diphenylpropanoyloxy)ethyl-trimethylazanium |
|---|---|
| PubChem CID | 21299458 |
| Molecular Formula | C20H26NO2+ |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 2-(2,2-diphenylpropanoyloxy)ethyl-trimethylazanium |
| SMILES | CC(C(=O)OCC[N+](C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H26NO2/c1-20(17-11-7-5-8-12-17,18-13-9-6-10-14-18)19(22)23-16-15-21(2,3)4/h5-14H,15-16H2,1-4H3/q+1 |
| InChIKey | XZCHENKOVCNAKZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|