C22H27NO2 — CID 45267220
2-(1-methylpyrrolidin-2-yl)ethyl 2,2-diphenylpropanoate (PubChem CID 45267220) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is 2-(1-methylpyrrolidin-2-yl)ethyl 2,2-diphenylpropanoate.
| Compound Name | 2-(1-methylpyrrolidin-2-yl)ethyl 2,2-diphenylpropanoate |
|---|---|
| PubChem CID | 45267220 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 2-(1-methylpyrrolidin-2-yl)ethyl 2,2-diphenylpropanoate |
| SMILES | CN1CCCC1CCOC(=O)C(C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H27NO2/c1-22(18-10-5-3-6-11-18,19-12-7-4-8-13-19)21(24)25-17-15-20-14-9-16-23(20)2/h3-8,10-13,20H,9,14-17H2,1-2H3 |
| InChIKey | QJNQIEXTHCSKSI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |