C12H17NO3 — CID 23738695
2-(1-methylpyrrolidin-2-yl)ethyl furan-2-carboxylate (PubChem CID 23738695) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 2-(1-methylpyrrolidin-2-yl)ethyl furan-2-carboxylate.
| Compound Name | 2-(1-methylpyrrolidin-2-yl)ethyl furan-2-carboxylate |
|---|---|
| PubChem CID | 23738695 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 2-(1-methylpyrrolidin-2-yl)ethyl furan-2-carboxylate |
| SMILES | CN1CCCC1CCOC(=O)c1ccco1 |
| InChI | InChI=1S/C12H17NO3/c1-13-7-2-4-10(13)6-9-16-12(14)11-5-3-8-15-11/h3,5,8,10H,2,4,6-7,9H2,1H3 |
| InChIKey | RYQBPLGXEQBCFV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |