C14H22ClNO3 — CID 3050997
3-(2-methylpiperidin-1-yl)propyl furan-2-carboxylate;hydrochloride (PubChem CID 3050997) has the molecular formula C14H22ClNO3 and a molecular weight of 287.79 g/mol. Its IUPAC name is 3-(2-methylpiperidin-1-yl)propyl furan-2-carboxylate;hydrochloride.
| Compound Name | 3-(2-methylpiperidin-1-yl)propyl furan-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 3050997 |
| Molecular Formula | C14H22ClNO3 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 3-(2-methylpiperidin-1-yl)propyl furan-2-carboxylate;hydrochloride |
| SMILES | CC1CCCCN1CCCOC(=O)c1ccco1.Cl |
| InChI | InChI=1S/C14H21NO3.ClH/c1-12-6-2-3-8-15(12)9-5-11-18-14(16)13-7-4-10-17-13;/h4,7,10,12H,2-3,5-6,8-9,11H2,1H3;1H |
| InChIKey | KXLWFNYPHDJYSH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|