C20H28ClNO3 — CID 134109001
3-(2-methylpiperidin-1-yl)propyl 3,6-dimethyl-1-benzofuran-2-carboxylate;hydrochloride (PubChem CID 134109001) has the molecular formula C20H28ClNO3 and a molecular weight of 365.90 g/mol. Its IUPAC name is 3-(2-methylpiperidin-1-yl)propyl 3,6-dimethyl-1-benzofuran-2-carboxylate;hydrochloride.
| Compound Name | 3-(2-methylpiperidin-1-yl)propyl 3,6-dimethyl-1-benzofuran-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 134109001 |
| Molecular Formula | C20H28ClNO3 |
| Molecular Weight | 365.90 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 3-(2-methylpiperidin-1-yl)propyl 3,6-dimethyl-1-benzofuran-2-carboxylate;hydrochloride |
| SMILES | Cc1ccc2c(C)c(C(=O)OCCCN3CCCCC3C)oc2c1.Cl |
| InChI | InChI=1S/C20H27NO3.ClH/c1-14-8-9-17-16(3)19(24-18(17)13-14)20(22)23-12-6-11-21-10-5-4-7-15(21)2;/h8-9,13,15H,4-7,10-12H2,1-3H3;1H |
| InChIKey | YBOLZZWRRKQUKZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.90 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|