C16H24ClNO3 — CID 3051416
3-(2-methylpiperidin-1-yl)propyl 2-hydroxybenzoate;hydrochloride (PubChem CID 3051416) has the molecular formula C16H24ClNO3 and a molecular weight of 313.82 g/mol. Its IUPAC name is 3-(2-methylpiperidin-1-yl)propyl 2-hydroxybenzoate;hydrochloride.
| Compound Name | 3-(2-methylpiperidin-1-yl)propyl 2-hydroxybenzoate;hydrochloride |
|---|---|
| PubChem CID | 3051416 |
| Molecular Formula | C16H24ClNO3 |
| Molecular Weight | 313.82 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 3-(2-methylpiperidin-1-yl)propyl 2-hydroxybenzoate;hydrochloride |
| SMILES | CC1CCCCN1CCCOC(=O)c1ccccc1O.Cl |
| InChI | InChI=1S/C16H23NO3.ClH/c1-13-7-4-5-10-17(13)11-6-12-20-16(19)14-8-2-3-9-15(14)18;/h2-3,8-9,13,18H,4-7,10-12H2,1H3;1H |
| InChIKey | JWWXCTWMACRUBN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.82 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|