About 2-piperidin-1-ylethyl 2-hydroxybenzoate
2-piperidin-1-ylethyl 2-hydroxybenzoate (PubChem CID 12633972) has the molecular formula C14H19NO3
and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-piperidin-1-ylethyl 2-hydroxybenzoate.
Molecular Properties
| Compound Name | 2-piperidin-1-ylethyl 2-hydroxybenzoate |
| PubChem CID | 12633972 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 2-piperidin-1-ylethyl 2-hydroxybenzoate |
| SMILES | O=C(OCCN1CCCCC1)c1ccccc1O |
| InChI | InChI=1S/C14H19NO3/c16-13-7-3-2-6-12(13)14(17)18-11-10-15-8-4-1-5-9-15/h2-3,6-7,16H,1,4-5,8-11H2 |
| InChIKey | RWTDJPMRNCSFGF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-piperidin-1-ylethyl 2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-ylethyl 2-hydroxybenzoate?
The IUPAC name of 2-piperidin-1-ylethyl 2-hydroxybenzoate (CID 12633972) is 2-piperidin-1-ylethyl 2-hydroxybenzoate.
What is the SMILES notation for 2-piperidin-1-ylethyl 2-hydroxybenzoate?
The canonical SMILES for 2-piperidin-1-ylethyl 2-hydroxybenzoate is O=C(OCCN1CCCCC1)c1ccccc1O.
What is the InChIKey of 2-piperidin-1-ylethyl 2-hydroxybenzoate?
The InChIKey is RWTDJPMRNCSFGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO3/c16-13-7-3-2-6-12(13)14(17)18-11-10-15-8-4-1-5-9-15/h2-3,6-7,16H,1,4-5,8-11H2.
What are the key properties of 2-piperidin-1-ylethyl 2-hydroxybenzoate?
2-piperidin-1-ylethyl 2-hydroxybenzoate has a molecular weight of 249.31 g/mol, XLogP of 2.03, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-ylethyl 2-hydroxybenzoate is sourced from PubChem (CID 12633972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).